C14H10BrClF2OS — CID 107540962
1-(2-bromo-3,4-difluorophenyl)-2-(2-chlorophenyl)sulfanylethanol (PubChem CID 107540962) has the molecular formula C14H10BrClF2OS and a molecular weight of 379.65 g/mol. Its IUPAC name is 1-(2-bromo-3,4-difluorophenyl)-2-(2-chlorophenyl)sulfanylethanol.
| Compound Name | 1-(2-bromo-3,4-difluorophenyl)-2-(2-chlorophenyl)sulfanylethanol |
|---|---|
| PubChem CID | 107540962 |
| Molecular Formula | C14H10BrClF2OS |
| Molecular Weight | 379.65 g/mol |
| Exact Mass | 377.93 |
| IUPAC Name | 1-(2-bromo-3,4-difluorophenyl)-2-(2-chlorophenyl)sulfanylethanol |
| SMILES | OC(CSc1ccccc1Cl)c1ccc(F)c(F)c1Br |
| InChI | InChI=1S/C14H10BrClF2OS/c15-13-8(5-6-10(17)14(13)18)11(19)7-20-12-4-2-1-3-9(12)16/h1-6,11,19H,7H2 |
| InChIKey | HMEWMFFNRMPKIR-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.65 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|