C9H9F4NO — CID 79722278
4,4,4-trifluoro-1-(5-fluoro-2-pyridinyl)butan-1-ol (PubChem CID 79722278) has the molecular formula C9H9F4NO and a molecular weight of 223.17 g/mol. Its IUPAC name is 4,4,4-trifluoro-1-(5-fluoro-2-pyridinyl)butan-1-ol.
| Compound Name | 4,4,4-trifluoro-1-(5-fluoro-2-pyridinyl)butan-1-ol |
|---|---|
| PubChem CID | 79722278 |
| Molecular Formula | C9H9F4NO |
| Molecular Weight | 223.17 g/mol |
| Exact Mass | 223.06 |
| IUPAC Name | 4,4,4-trifluoro-1-(5-fluoro-2-pyridinyl)butan-1-ol |
| SMILES | OC(CCC(F)(F)F)c1ccc(F)cn1 |
| InChI | InChI=1S/C9H9F4NO/c10-6-1-2-7(14-5-6)8(15)3-4-9(11,12)13/h1-2,5,8,15H,3-4H2 |
| InChIKey | FRJSXBMGXUAIOC-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.17 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |