C11H17FN2O — CID 138472981
2-(tert-butylamino)-1-(5-fluoro-2-pyridinyl)ethanol (PubChem CID 138472981) has the molecular formula C11H17FN2O and a molecular weight of 212.27 g/mol. Its IUPAC name is 2-(tert-butylamino)-1-(5-fluoro-2-pyridinyl)ethanol.
| Compound Name | 2-(tert-butylamino)-1-(5-fluoro-2-pyridinyl)ethanol |
|---|---|
| PubChem CID | 138472981 |
| Molecular Formula | C11H17FN2O |
| Molecular Weight | 212.27 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | 2-(tert-butylamino)-1-(5-fluoro-2-pyridinyl)ethanol |
| SMILES | CC(C)(C)NCC(O)c1ccc(F)cn1 |
| InChI | InChI=1S/C11H17FN2O/c1-11(2,3)14-7-10(15)9-5-4-8(12)6-13-9/h4-6,10,14-15H,7H2,1-3H3 |
| InChIKey | FEYHZZDRBBHTDF-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.27 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |