C18H16F6S2 — CID 87128309
[3,3,3-trifluoro-1-[(3,3,3-trifluoro-1-phenylpropyl)disulfanyl]propyl]benzene (PubChem CID 87128309) has the molecular formula C18H16F6S2 and a molecular weight of 410.45 g/mol. Its IUPAC name is [3,3,3-trifluoro-1-[(3,3,3-trifluoro-1-phenylpropyl)disulfanyl]propyl]benzene.
| Compound Name | [3,3,3-trifluoro-1-[(3,3,3-trifluoro-1-phenylpropyl)disulfanyl]propyl]benzene |
|---|---|
| PubChem CID | 87128309 |
| Molecular Formula | C18H16F6S2 |
| Molecular Weight | 410.45 g/mol |
| Exact Mass | 410.06 |
| IUPAC Name | [3,3,3-trifluoro-1-[(3,3,3-trifluoro-1-phenylpropyl)disulfanyl]propyl]benzene |
| SMILES | FC(F)(F)CC(SSC(CC(F)(F)F)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H16F6S2/c19-17(20,21)11-15(13-7-3-1-4-8-13)25-26-16(12-18(22,23)24)14-9-5-2-6-10-14/h1-10,15-16H,11-12H2 |
| InChIKey | OYQORDUCNPQCJQ-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.45 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|