C16H12F6S2 — CID 87395702
[2,2,2-trifluoro-1-[(2,2,2-trifluoro-1-phenylethyl)disulfanyl]ethyl]benzene (PubChem CID 87395702) has the molecular formula C16H12F6S2 and a molecular weight of 382.39 g/mol. Its IUPAC name is [2,2,2-trifluoro-1-[(2,2,2-trifluoro-1-phenylethyl)disulfanyl]ethyl]benzene.
| Compound Name | [2,2,2-trifluoro-1-[(2,2,2-trifluoro-1-phenylethyl)disulfanyl]ethyl]benzene |
|---|---|
| PubChem CID | 87395702 |
| Molecular Formula | C16H12F6S2 |
| Molecular Weight | 382.39 g/mol |
| Exact Mass | 382.03 |
| IUPAC Name | [2,2,2-trifluoro-1-[(2,2,2-trifluoro-1-phenylethyl)disulfanyl]ethyl]benzene |
| SMILES | FC(F)(F)C(SSC(c1ccccc1)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C16H12F6S2/c17-15(18,19)13(11-7-3-1-4-8-11)23-24-14(16(20,21)22)12-9-5-2-6-10-12/h1-10,13-14H |
| InChIKey | CQVGQOTUENZPSE-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.39 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|