C14H12F3N — CID 70275590
N-benzhydryl-1,1,1-trifluoromethanamine (PubChem CID 70275590) has the molecular formula C14H12F3N and a molecular weight of 251.25 g/mol. Its IUPAC name is N-benzhydryl-1,1,1-trifluoromethanamine.
| Compound Name | N-benzhydryl-1,1,1-trifluoromethanamine |
|---|---|
| PubChem CID | 70275590 |
| Molecular Formula | C14H12F3N |
| Molecular Weight | 251.25 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | N-benzhydryl-1,1,1-trifluoromethanamine |
| SMILES | FC(F)(F)NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H12F3N/c15-14(16,17)18-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,13,18H |
| InChIKey | FKEXSKQUIZOOJU-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.25 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|