C34H32F4N2O2 — CID 4162787
N,N'-bis(3,3-diphenylpropyl)-2,2,3,3-tetrafluorobutanediamide (PubChem CID 4162787) has the molecular formula C34H32F4N2O2 and a molecular weight of 576.63 g/mol. Its IUPAC name is N,N'-bis(3,3-diphenylpropyl)-2,2,3,3-tetrafluorobutanediamide.
| Compound Name | N,N'-bis(3,3-diphenylpropyl)-2,2,3,3-tetrafluorobutanediamide |
|---|---|
| PubChem CID | 4162787 |
| Molecular Formula | C34H32F4N2O2 |
| Molecular Weight | 576.63 g/mol |
| Exact Mass | 576.24 |
| IUPAC Name | N,N'-bis(3,3-diphenylpropyl)-2,2,3,3-tetrafluorobutanediamide |
| SMILES | O=C(NCCC(c1ccccc1)c1ccccc1)C(F)(F)C(F)(F)C(=O)NCCC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H32F4N2O2/c35-33(36,31(41)39-23-21-29(25-13-5-1-6-14-25)26-15-7-2-8-16-26)34(37,38)32(42)40-24-22-30(27-17-9-3-10-18-27)28-19-11-4-12-20-28/h1-20,29-30H,21-24H2,(H,39,41)(H,40,42) |
| InChIKey | FODHHVITUOIARC-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.63 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|