C10H10F5N2S+ — CID 134110625
[amino-[(2,3,4,5,6-pentafluorophenyl)methylsulfanyl]methylidene]-dimethylazanium (PubChem CID 134110625) has the molecular formula C10H10F5N2S+ and a molecular weight of 285.26 g/mol. Its IUPAC name is [amino-[(2,3,4,5,6-pentafluorophenyl)methylsulfanyl]methylidene]-dimethylazanium.
| Compound Name | [amino-[(2,3,4,5,6-pentafluorophenyl)methylsulfanyl]methylidene]-dimethylazanium |
|---|---|
| PubChem CID | 134110625 |
| Molecular Formula | C10H10F5N2S+ |
| Molecular Weight | 285.26 g/mol |
| Exact Mass | 285.05 |
| IUPAC Name | [amino-[(2,3,4,5,6-pentafluorophenyl)methylsulfanyl]methylidene]-dimethylazanium |
| SMILES | C[N+](C)=C(N)SCc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C10H9F5N2S/c1-17(2)10(16)18-3-4-5(11)7(13)9(15)8(14)6(4)12/h16H,3H2,1-2H3/p+1 |
| InChIKey | OAPLTMGBKDOXTA-UHFFFAOYSA-O |
| XLogP | 2.20 |
| TPSA | 29.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.26 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|