C16H4F10NO2S2- — CID 134102820
1,2,3,4,5-pentafluoro-6-[[2-nitro-1-[(2,3,4,5,6-pentafluorophenyl)methylsulfanyl]ethenyl]sulfanylmethyl]benzene (PubChem CID 134102820) has the molecular formula C16H4F10NO2S2- and a molecular weight of 496.33 g/mol. Its IUPAC name is 1,2,3,4,5-pentafluoro-6-[[2-nitro-1-[(2,3,4,5,6-pentafluorophenyl)methylsulfanyl]ethenyl]sulfanylmethyl]benzene.
| Compound Name | 1,2,3,4,5-pentafluoro-6-[[2-nitro-1-[(2,3,4,5,6-pentafluorophenyl)methylsulfanyl]ethenyl]sulfanylmethyl]benzene |
|---|---|
| PubChem CID | 134102820 |
| Molecular Formula | C16H4F10NO2S2- |
| Molecular Weight | 496.33 g/mol |
| Exact Mass | 495.95 |
| IUPAC Name | 1,2,3,4,5-pentafluoro-6-[[2-nitro-1-[(2,3,4,5,6-pentafluorophenyl)methylsulfanyl]ethenyl]sulfanylmethyl]benzene |
| SMILES | O=[N+]([O-])[C-]=C(SCc1c(F)c(F)c(F)c(F)c1F)SCc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C16H4F10NO2S2/c17-7-4(8(18)12(22)15(25)11(7)21)2-30-6(1-27(28)29)31-3-5-9(19)13(23)16(26)14(24)10(5)20/h2-3H2/q-1 |
| InChIKey | MEQAHLLFESMXFD-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.33 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|