C13H6F5NO3S — CID 132605369
1,2,3,4,5-pentafluoro-6-[(4-nitrophenyl)sulfinylmethyl]benzene (PubChem CID 132605369) has the molecular formula C13H6F5NO3S and a molecular weight of 351.25 g/mol. Its IUPAC name is 1,2,3,4,5-pentafluoro-6-[(4-nitrophenyl)sulfinylmethyl]benzene.
| Compound Name | 1,2,3,4,5-pentafluoro-6-[(4-nitrophenyl)sulfinylmethyl]benzene |
|---|---|
| PubChem CID | 132605369 |
| Molecular Formula | C13H6F5NO3S |
| Molecular Weight | 351.25 g/mol |
| Exact Mass | 351.00 |
| IUPAC Name | 1,2,3,4,5-pentafluoro-6-[(4-nitrophenyl)sulfinylmethyl]benzene |
| SMILES | O=[N+]([O-])c1ccc(S(=O)Cc2c(F)c(F)c(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C13H6F5NO3S/c14-9-8(10(15)12(17)13(18)11(9)16)5-23(22)7-3-1-6(2-4-7)19(20)21/h1-4H,5H2 |
| InChIKey | CGOOIYROORERKI-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.25 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|