C23H36N2O4S2 — CID 167594513
4-(2,2-dimethylpropylsulfinyl)aniline;1-(2,2-dimethylpropylsulfinyl)-4-nitrobenzene;methane (PubChem CID 167594513) has the molecular formula C23H36N2O4S2 and a molecular weight of 468.69 g/mol. Its IUPAC name is 4-(2,2-dimethylpropylsulfinyl)aniline;1-(2,2-dimethylpropylsulfinyl)-4-nitrobenzene;methane.
| Compound Name | 4-(2,2-dimethylpropylsulfinyl)aniline;1-(2,2-dimethylpropylsulfinyl)-4-nitrobenzene;methane |
|---|---|
| PubChem CID | 167594513 |
| Molecular Formula | C23H36N2O4S2 |
| Molecular Weight | 468.69 g/mol |
| Exact Mass | 468.21 |
| IUPAC Name | 4-(2,2-dimethylpropylsulfinyl)aniline;1-(2,2-dimethylpropylsulfinyl)-4-nitrobenzene;methane |
| SMILES | C.CC(C)(C)CS(=O)c1ccc(N)cc1.CC(C)(C)CS(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C11H15NO3S.C11H17NOS.CH4/c1-11(2,3)8-16(15)10-6-4-9(5-7-10)12(13)14;1-11(2,3)8-14(13)10-6-4-9(12)5-7-10;/h4-7H,8H2,1-3H3;4-7H,8,12H2,1-3H3;1H4 |
| InChIKey | IWINUVFQTDWJCI-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 103.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.69 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|