C7H3Cl2F5Si — CID 154057853
dichloro-[(2,3,4,5,6-pentafluorophenyl)methyl]silane (PubChem CID 154057853) has the molecular formula C7H3Cl2F5Si and a molecular weight of 281.08 g/mol. Its IUPAC name is dichloro-[(2,3,4,5,6-pentafluorophenyl)methyl]silane.
| Compound Name | dichloro-[(2,3,4,5,6-pentafluorophenyl)methyl]silane |
|---|---|
| PubChem CID | 154057853 |
| Molecular Formula | C7H3Cl2F5Si |
| Molecular Weight | 281.08 g/mol |
| Exact Mass | 279.93 |
| IUPAC Name | dichloro-[(2,3,4,5,6-pentafluorophenyl)methyl]silane |
| SMILES | Fc1c(F)c(F)c(C[SiH](Cl)Cl)c(F)c1F |
| InChI | InChI=1S/C7H3Cl2F5Si/c8-15(9)1-2-3(10)5(12)7(14)6(13)4(2)11/h15H,1H2 |
| InChIKey | RZQBUHLRWHBVCL-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.08 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|