C16H10F10N+ — CID 102098933
dimethyl-bis[(2,3,4,5,6-pentafluorophenyl)methyl]azanium (PubChem CID 102098933) has the molecular formula C16H10F10N+ and a molecular weight of 406.24 g/mol. Its IUPAC name is dimethyl-bis[(2,3,4,5,6-pentafluorophenyl)methyl]azanium.
| Compound Name | dimethyl-bis[(2,3,4,5,6-pentafluorophenyl)methyl]azanium |
|---|---|
| PubChem CID | 102098933 |
| Molecular Formula | C16H10F10N+ |
| Molecular Weight | 406.24 g/mol |
| Exact Mass | 406.06 |
| IUPAC Name | dimethyl-bis[(2,3,4,5,6-pentafluorophenyl)methyl]azanium |
| SMILES | C[N+](C)(Cc1c(F)c(F)c(F)c(F)c1F)Cc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C16H10F10N/c1-27(2,3-5-7(17)11(21)15(25)12(22)8(5)18)4-6-9(19)13(23)16(26)14(24)10(6)20/h3-4H2,1-2H3/q+1 |
| InChIKey | LOGIVJQUBRTBKF-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.24 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|