C12H17NS2 — CID 121001692
(2,4-dimethylphenyl)methyl N,N-dimethylcarbamodithioate (PubChem CID 121001692) has the molecular formula C12H17NS2 and a molecular weight of 239.41 g/mol. Its IUPAC name is (2,4-dimethylphenyl)methyl N,N-dimethylcarbamodithioate.
| Compound Name | (2,4-dimethylphenyl)methyl N,N-dimethylcarbamodithioate |
|---|---|
| PubChem CID | 121001692 |
| Molecular Formula | C12H17NS2 |
| Molecular Weight | 239.41 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | (2,4-dimethylphenyl)methyl N,N-dimethylcarbamodithioate |
| SMILES | Cc1ccc(CSC(=S)N(C)C)c(C)c1 |
| InChI | InChI=1S/C12H17NS2/c1-9-5-6-11(10(2)7-9)8-15-12(14)13(3)4/h5-7H,8H2,1-4H3 |
| InChIKey | XFQYXMSSSNJIRR-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.41 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|