C4H8NO3S3- — CID 23517441
dimethylcarbamothioylsulfanylmethanesulfonate (PubChem CID 23517441) has the molecular formula C4H8NO3S3- and a molecular weight of 214.31 g/mol. Its IUPAC name is dimethylcarbamothioylsulfanylmethanesulfonate.
| Compound Name | dimethylcarbamothioylsulfanylmethanesulfonate |
|---|---|
| PubChem CID | 23517441 |
| Molecular Formula | C4H8NO3S3- |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 213.97 |
| IUPAC Name | dimethylcarbamothioylsulfanylmethanesulfonate |
| SMILES | CN(C)C(=S)SCS(=O)(=O)[O-] |
| InChI | InChI=1S/C4H9NO3S3/c1-5(2)4(9)10-3-11(6,7)8/h3H2,1-2H3,(H,6,7,8)/p-1 |
| InChIKey | IIPPHFVTLPAVCA-UHFFFAOYSA-M |
| XLogP | 0.07 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|