C6H12NNaO3S3 — CID 23699056
sodium 1-(dimethylcarbamothioylsulfanyl)propane-1-sulfonate (PubChem CID 23699056) has the molecular formula C6H12NNaO3S3 and a molecular weight of 265.36 g/mol. Its IUPAC name is sodium 1-(dimethylcarbamothioylsulfanyl)propane-1-sulfonate.
| Compound Name | sodium 1-(dimethylcarbamothioylsulfanyl)propane-1-sulfonate |
|---|---|
| PubChem CID | 23699056 |
| Molecular Formula | C6H12NNaO3S3 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 264.99 |
| IUPAC Name | sodium 1-(dimethylcarbamothioylsulfanyl)propane-1-sulfonate |
| SMILES | CCC(SC(=S)N(C)C)S(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C6H13NO3S3.Na/c1-4-5(13(8,9)10)12-6(11)7(2)3;/h5H,4H2,1-3H3,(H,8,9,10);/q;+1/p-1 |
| InChIKey | WTWFHIRKROBROJ-UHFFFAOYSA-M |
| XLogP | -2.15 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | -2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|