C5H12NNaO4S4 — CID 174796782
sodium 1,3-bis(hydroxysulfonothioyl)-N,N-dimethylpropan-2-amine (PubChem CID 174796782) has the molecular formula C5H12NNaO4S4 and a molecular weight of 301.41 g/mol. Its IUPAC name is sodium 1,3-bis(hydroxysulfonothioyl)-N,N-dimethylpropan-2-amine.
| Compound Name | sodium 1,3-bis(hydroxysulfonothioyl)-N,N-dimethylpropan-2-amine |
|---|---|
| PubChem CID | 174796782 |
| Molecular Formula | C5H12NNaO4S4 |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 300.95 |
| IUPAC Name | sodium 1,3-bis(hydroxysulfonothioyl)-N,N-dimethylpropan-2-amine |
| SMILES | CN(C)C([CH-]S(=O)(O)=S)CS(=O)(O)=S.[Na+] |
| InChI | InChI=1S/C5H12NO4S4.Na/c1-6(2)5(3-13(7,8)11)4-14(9,10)12;/h3,5H,4H2,1-2H3,(H,7,8,11)(H,9,10,12);/q-1;+1 |
| InChIKey | GNOOBNBCTWNKHP-UHFFFAOYSA-N |
| XLogP | -3.48 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | -3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|