C5H11NOS3 — CID 134917440
methylsulfinylmethyl N,N-dimethylcarbamodithioate (PubChem CID 134917440) has the molecular formula C5H11NOS3 and a molecular weight of 197.35 g/mol. Its IUPAC name is methylsulfinylmethyl N,N-dimethylcarbamodithioate.
| Compound Name | methylsulfinylmethyl N,N-dimethylcarbamodithioate |
|---|---|
| PubChem CID | 134917440 |
| Molecular Formula | C5H11NOS3 |
| Molecular Weight | 197.35 g/mol |
| Exact Mass | 197.00 |
| IUPAC Name | methylsulfinylmethyl N,N-dimethylcarbamodithioate |
| SMILES | CN(C)C(=S)SCS(C)=O |
| InChI | InChI=1S/C5H11NOS3/c1-6(2)5(8)9-4-10(3)7/h4H2,1-3H3 |
| InChIKey | GARRTYUREYVHID-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.35 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|