C9H18Cl3N2O3PS2 — CID 10597319
[2,2,2-trichloro-1-(diethoxyphosphorylamino)ethyl] N,N-dimethylcarbamodithioate (PubChem CID 10597319) has the molecular formula C9H18Cl3N2O3PS2 and a molecular weight of 403.72 g/mol. Its IUPAC name is [2,2,2-trichloro-1-(diethoxyphosphorylamino)ethyl] N,N-dimethylcarbamodithioate.
| Compound Name | [2,2,2-trichloro-1-(diethoxyphosphorylamino)ethyl] N,N-dimethylcarbamodithioate |
|---|---|
| PubChem CID | 10597319 |
| Molecular Formula | C9H18Cl3N2O3PS2 |
| Molecular Weight | 403.72 g/mol |
| Exact Mass | 401.96 |
| IUPAC Name | [2,2,2-trichloro-1-(diethoxyphosphorylamino)ethyl] N,N-dimethylcarbamodithioate |
| SMILES | CCOP(=O)(NC(SC(=S)N(C)C)C(Cl)(Cl)Cl)OCC |
| InChI | InChI=1S/C9H18Cl3N2O3PS2/c1-5-16-18(15,17-6-2)13-7(9(10,11)12)20-8(19)14(3)4/h7H,5-6H2,1-4H3,(H,13,15) |
| InChIKey | NLORCGUXRIXFJQ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.72 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|