C13H27N2O3PS5 — CID 11465107
[diethoxyphosphoryl-(dimethylcarbamothioylsulfanyl)-ethylsulfanylmethyl] N,N-dimethylcarbamodithioate (PubChem CID 11465107) has the molecular formula C13H27N2O3PS5 and a molecular weight of 450.68 g/mol. Its IUPAC name is [diethoxyphosphoryl-(dimethylcarbamothioylsulfanyl)-ethylsulfanylmethyl] N,N-dimethylcarbamodithioate.
| Compound Name | [diethoxyphosphoryl-(dimethylcarbamothioylsulfanyl)-ethylsulfanylmethyl] N,N-dimethylcarbamodithioate |
|---|---|
| PubChem CID | 11465107 |
| Molecular Formula | C13H27N2O3PS5 |
| Molecular Weight | 450.68 g/mol |
| Exact Mass | 450.04 |
| IUPAC Name | [diethoxyphosphoryl-(dimethylcarbamothioylsulfanyl)-ethylsulfanylmethyl] N,N-dimethylcarbamodithioate |
| SMILES | CCOP(=O)(OCC)C(SCC)(SC(=S)N(C)C)SC(=S)N(C)C |
| InChI | InChI=1S/C13H27N2O3PS5/c1-8-17-19(16,18-9-2)13(22-10-3,23-11(20)14(4)5)24-12(21)15(6)7/h8-10H2,1-7H3 |
| InChIKey | NPZFPYWKYMMJHA-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.68 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|