C14H19Cl4N2O3PS2 — CID 57042782
3-(3-chlorophenyl)-1-methyl-1-(2,2,2-trichloro-1-diethoxyphosphinothioylsulfanylethyl)urea (PubChem CID 57042782) has the molecular formula C14H19Cl4N2O3PS2 and a molecular weight of 500.24 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-1-methyl-1-(2,2,2-trichloro-1-diethoxyphosphinothioylsulfanylethyl)urea.
| Compound Name | 3-(3-chlorophenyl)-1-methyl-1-(2,2,2-trichloro-1-diethoxyphosphinothioylsulfanylethyl)urea |
|---|---|
| PubChem CID | 57042782 |
| Molecular Formula | C14H19Cl4N2O3PS2 |
| Molecular Weight | 500.24 g/mol |
| Exact Mass | 497.93 |
| IUPAC Name | 3-(3-chlorophenyl)-1-methyl-1-(2,2,2-trichloro-1-diethoxyphosphinothioylsulfanylethyl)urea |
| SMILES | CCOP(=S)(OCC)SC(N(C)C(=O)Nc1cccc(Cl)c1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C14H19Cl4N2O3PS2/c1-4-22-24(25,23-5-2)26-12(14(16,17)18)20(3)13(21)19-11-8-6-7-10(15)9-11/h6-9,12H,4-5H2,1-3H3,(H,19,21) |
| InChIKey | KZDDJBVHJMCYFM-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.24 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|