About ethyl N-[(3-chlorophenyl)carbamoyl]-N'-(dimethylcarbamoyl)-N-propan-2-ylcarbamimidothioate
ethyl N-[(3-chlorophenyl)carbamoyl]-N'-(dimethylcarbamoyl)-N-propan-2-ylcarbamimidothioate (PubChem CID 54504793) has the molecular formula C16H23ClN4O2S
and a molecular weight of 370.91 g/mol. Its IUPAC name is ethyl N-[(3-chlorophenyl)carbamoyl]-N'-(dimethylcarbamoyl)-N-propan-2-ylcarbamimidothioate.
Molecular Properties
| Compound Name | ethyl N-[(3-chlorophenyl)carbamoyl]-N'-(dimethylcarbamoyl)-N-propan-2-ylcarbamimidothioate |
| PubChem CID | 54504793 |
| Molecular Formula | C16H23ClN4O2S |
| Molecular Weight | 370.91 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | ethyl N-[(3-chlorophenyl)carbamoyl]-N'-(dimethylcarbamoyl)-N-propan-2-ylcarbamimidothioate |
| SMILES | CCSC(=NC(=O)N(C)C)N(C(=O)Nc1cccc(Cl)c1)C(C)C |
| InChI | InChI=1S/C16H23ClN4O2S/c1-6-24-16(19-14(22)20(4)5)21(11(2)3)15(23)18-13-9-7-8-12(17)10-13/h7-11H,6H2,1-5H3,(H,18,23) |
| InChIKey | YEXVELMUBFUTMM-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.91 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze ethyl N-[(3-chlorophenyl)carbamoyl]-N'-(dimethylcarbamoyl)-N-propan-2-ylcarbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-[(3-chlorophenyl)carbamoyl]-N'-(dimethylcarbamoyl)-N-propan-2-ylcarbamimidothioate?
The IUPAC name of ethyl N-[(3-chlorophenyl)carbamoyl]-N'-(dimethylcarbamoyl)-N-propan-2-ylcarbamimidothioate (CID 54504793) is ethyl N-[(3-chlorophenyl)carbamoyl]-N'-(dimethylcarbamoyl)-N-propan-2-ylcarbamimidothioate.
What is the SMILES notation for ethyl N-[(3-chlorophenyl)carbamoyl]-N'-(dimethylcarbamoyl)-N-propan-2-ylcarbamimidothioate?
The canonical SMILES for ethyl N-[(3-chlorophenyl)carbamoyl]-N'-(dimethylcarbamoyl)-N-propan-2-ylcarbamimidothioate is CCSC(=NC(=O)N(C)C)N(C(=O)Nc1cccc(Cl)c1)C(C)C.
What is the InChIKey of ethyl N-[(3-chlorophenyl)carbamoyl]-N'-(dimethylcarbamoyl)-N-propan-2-ylcarbamimidothioate?
The InChIKey is YEXVELMUBFUTMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23ClN4O2S/c1-6-24-16(19-14(22)20(4)5)21(11(2)3)15(23)18-13-9-7-8-12(17)10-13/h7-11H,6H2,1-5H3,(H,18,23).
What are the key properties of ethyl N-[(3-chlorophenyl)carbamoyl]-N'-(dimethylcarbamoyl)-N-propan-2-ylcarbamimidothioate?
ethyl N-[(3-chlorophenyl)carbamoyl]-N'-(dimethylcarbamoyl)-N-propan-2-ylcarbamimidothioate has a molecular weight of 370.91 g/mol, XLogP of 4.37, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-[(3-chlorophenyl)carbamoyl]-N'-(dimethylcarbamoyl)-N-propan-2-ylcarbamimidothioate is sourced from PubChem (CID 54504793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).