C14H18ClN3OS — CID 134110622
cyclopropylmethyl N'-[(3-chlorophenyl)carbamoyl]-N,N-dimethylcarbamimidothioate (PubChem CID 134110622) has the molecular formula C14H18ClN3OS and a molecular weight of 311.84 g/mol. Its IUPAC name is cyclopropylmethyl N'-[(3-chlorophenyl)carbamoyl]-N,N-dimethylcarbamimidothioate.
| Compound Name | cyclopropylmethyl N'-[(3-chlorophenyl)carbamoyl]-N,N-dimethylcarbamimidothioate |
|---|---|
| PubChem CID | 134110622 |
| Molecular Formula | C14H18ClN3OS |
| Molecular Weight | 311.84 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | cyclopropylmethyl N'-[(3-chlorophenyl)carbamoyl]-N,N-dimethylcarbamimidothioate |
| SMILES | CN(C)/C(=N\C(=O)Nc1cccc(Cl)c1)SCC1CC1 |
| InChI | InChI=1S/C14H18ClN3OS/c1-18(2)14(20-9-10-6-7-10)17-13(19)16-12-5-3-4-11(15)8-12/h3-5,8,10H,6-7,9H2,1-2H3,(H,16,19)/b17-14+ |
| InChIKey | QJSKOXUGJJAQBF-SAPNQHFASA-N |
| XLogP | 3.93 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.84 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|