C17H24Cl2N4O2S — CID 54407315
ethyl N-butan-2-yl-N-[(3,5-dichlorophenyl)carbamoyl]-N'-(dimethylcarbamoyl)carbamimidothioate (PubChem CID 54407315) has the molecular formula C17H24Cl2N4O2S and a molecular weight of 419.38 g/mol. Its IUPAC name is ethyl N-butan-2-yl-N-[(3,5-dichlorophenyl)carbamoyl]-N'-(dimethylcarbamoyl)carbamimidothioate.
| Compound Name | ethyl N-butan-2-yl-N-[(3,5-dichlorophenyl)carbamoyl]-N'-(dimethylcarbamoyl)carbamimidothioate |
|---|---|
| PubChem CID | 54407315 |
| Molecular Formula | C17H24Cl2N4O2S |
| Molecular Weight | 419.38 g/mol |
| Exact Mass | 418.10 |
| IUPAC Name | ethyl N-butan-2-yl-N-[(3,5-dichlorophenyl)carbamoyl]-N'-(dimethylcarbamoyl)carbamimidothioate |
| SMILES | CCSC(=NC(=O)N(C)C)N(C(=O)Nc1cc(Cl)cc(Cl)c1)C(C)CC |
| InChI | InChI=1S/C17H24Cl2N4O2S/c1-6-11(3)23(17(26-7-2)21-15(24)22(4)5)16(25)20-14-9-12(18)8-13(19)10-14/h8-11H,6-7H2,1-5H3,(H,20,25) |
| InChIKey | VRQCTEKURFGCEA-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.38 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|