C4H9NO4S2 — CID 141499445
azanium prop-2-enoylsulfanylmethanesulfonate (PubChem CID 141499445) has the molecular formula C4H9NO4S2 and a molecular weight of 199.25 g/mol. Its IUPAC name is azanium prop-2-enoylsulfanylmethanesulfonate.
| Compound Name | azanium prop-2-enoylsulfanylmethanesulfonate |
|---|---|
| PubChem CID | 141499445 |
| Molecular Formula | C4H9NO4S2 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.00 |
| IUPAC Name | azanium prop-2-enoylsulfanylmethanesulfonate |
| SMILES | C=CC(=O)SCS(=O)(=O)[O-].[NH4+] |
| InChI | InChI=1S/C4H6O4S2.H3N/c1-2-4(5)9-3-10(6,7)8;/h2H,1,3H2,(H,6,7,8);1H3 |
| InChIKey | MFNGROXHOYOMRL-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 110.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|