C6H8F2OS — CID 89332464
S-(3,3-difluoropropyl) prop-2-enethioate (PubChem CID 89332464) has the molecular formula C6H8F2OS and a molecular weight of 166.19 g/mol. Its IUPAC name is S-(3,3-difluoropropyl) prop-2-enethioate.
| Compound Name | S-(3,3-difluoropropyl) prop-2-enethioate |
|---|---|
| PubChem CID | 89332464 |
| Molecular Formula | C6H8F2OS |
| Molecular Weight | 166.19 g/mol |
| Exact Mass | 166.03 |
| IUPAC Name | S-(3,3-difluoropropyl) prop-2-enethioate |
| SMILES | C=CC(=O)SCCC(F)F |
| InChI | InChI=1S/C6H8F2OS/c1-2-6(9)10-4-3-5(7)8/h2,5H,1,3-4H2 |
| InChIKey | MCCSNESRPDANTA-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.19 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|