C9H7F9OS — CID 20727664
S-(3,3,4,4,5,5,6,6,6-nonafluorohexyl) prop-2-enethioate (PubChem CID 20727664) has the molecular formula C9H7F9OS and a molecular weight of 334.20 g/mol. Its IUPAC name is S-(3,3,4,4,5,5,6,6,6-nonafluorohexyl) prop-2-enethioate.
| Compound Name | S-(3,3,4,4,5,5,6,6,6-nonafluorohexyl) prop-2-enethioate |
|---|---|
| PubChem CID | 20727664 |
| Molecular Formula | C9H7F9OS |
| Molecular Weight | 334.20 g/mol |
| Exact Mass | 334.01 |
| IUPAC Name | S-(3,3,4,4,5,5,6,6,6-nonafluorohexyl) prop-2-enethioate |
| SMILES | C=CC(=O)SCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H7F9OS/c1-2-5(19)20-4-3-6(10,11)7(12,13)8(14,15)9(16,17)18/h2H,1,3-4H2 |
| InChIKey | JEEJJSLAUWOSBS-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.20 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|