C13H16F9NO2S — CID 165364771
S-(3,3,4,4,5,5,6,6,6-nonafluorohexyl) N-(6-oxohexyl)carbamothioate (PubChem CID 165364771) has the molecular formula C13H16F9NO2S and a molecular weight of 421.33 g/mol. Its IUPAC name is S-(3,3,4,4,5,5,6,6,6-nonafluorohexyl) N-(6-oxohexyl)carbamothioate.
| Compound Name | S-(3,3,4,4,5,5,6,6,6-nonafluorohexyl) N-(6-oxohexyl)carbamothioate |
|---|---|
| PubChem CID | 165364771 |
| Molecular Formula | C13H16F9NO2S |
| Molecular Weight | 421.33 g/mol |
| Exact Mass | 421.08 |
| IUPAC Name | S-(3,3,4,4,5,5,6,6,6-nonafluorohexyl) N-(6-oxohexyl)carbamothioate |
| SMILES | O=CCCCCCNC(=O)SCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H16F9NO2S/c14-10(15,11(16,17)12(18,19)13(20,21)22)5-8-26-9(25)23-6-3-1-2-4-7-24/h7H,1-6,8H2,(H,23,25) |
| InChIKey | DUBWOYCQLXYXOC-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.33 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|