(2,6-dibromo-4-fluorophenyl)methyl acetate

C9H7Br2FO2 — CID 67016593

IUPAC(2,6-dibromo-4-fluorophenyl)methyl acetate
SMILESCC(=O)OCc1c(Br)cc(F)cc1Br
InChIInChI=1S/C9H7Br2FO2/c1-5(13)14-4-7-8(10)2-6(12)3-9(7)11/h2-3H,4H2,1H3
InChIKeyACSZRXJPUQDJNW-UHFFFAOYSA-N
MW325.96 g/mol
LogP3.41
Rot. Bonds2

About (2,6-dibromo-4-fluorophenyl)methyl acetate

(2,6-dibromo-4-fluorophenyl)methyl acetate (PubChem CID 67016593) has the molecular formula C9H7Br2FO2 and a molecular weight of 325.96 g/mol. Its IUPAC name is (2,6-dibromo-4-fluorophenyl)methyl acetate.

Molecular Properties

Compound Name(2,6-dibromo-4-fluorophenyl)methyl acetate
PubChem CID67016593
Molecular FormulaC9H7Br2FO2
Molecular Weight325.96 g/mol
Exact Mass323.88
IUPAC Name(2,6-dibromo-4-fluorophenyl)methyl acetate
SMILESCC(=O)OCc1c(Br)cc(F)cc1Br
InChIInChI=1S/C9H7Br2FO2/c1-5(13)14-4-7-8(10)2-6(12)3-9(7)11/h2-3H,4H2,1H3
InChIKeyACSZRXJPUQDJNW-UHFFFAOYSA-N
XLogP3.41
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500325.96
LogP ≤ 53.41
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze (2,6-dibromo-4-fluorophenyl)methyl acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2,6-dibromo-4-fluorophenyl)methyl acetate?
The IUPAC name of (2,6-dibromo-4-fluorophenyl)methyl acetate (CID 67016593) is (2,6-dibromo-4-fluorophenyl)methyl acetate.
What is the SMILES notation for (2,6-dibromo-4-fluorophenyl)methyl acetate?
The canonical SMILES for (2,6-dibromo-4-fluorophenyl)methyl acetate is CC(=O)OCc1c(Br)cc(F)cc1Br.
What is the InChIKey of (2,6-dibromo-4-fluorophenyl)methyl acetate?
The InChIKey is ACSZRXJPUQDJNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7Br2FO2/c1-5(13)14-4-7-8(10)2-6(12)3-9(7)11/h2-3H,4H2,1H3.
What are the key properties of (2,6-dibromo-4-fluorophenyl)methyl acetate?
(2,6-dibromo-4-fluorophenyl)methyl acetate has a molecular weight of 325.96 g/mol, XLogP of 3.41, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2,6-dibromo-4-fluorophenyl)methyl acetate is sourced from PubChem (CID 67016593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).