C9H7Br2FO2 — CID 67016593
(2,6-dibromo-4-fluorophenyl)methyl acetate (PubChem CID 67016593) has the molecular formula C9H7Br2FO2 and a molecular weight of 325.96 g/mol. Its IUPAC name is (2,6-dibromo-4-fluorophenyl)methyl acetate.
| Compound Name | (2,6-dibromo-4-fluorophenyl)methyl acetate |
|---|---|
| PubChem CID | 67016593 |
| Molecular Formula | C9H7Br2FO2 |
| Molecular Weight | 325.96 g/mol |
| Exact Mass | 323.88 |
| IUPAC Name | (2,6-dibromo-4-fluorophenyl)methyl acetate |
| SMILES | CC(=O)OCc1c(Br)cc(F)cc1Br |
| InChI | InChI=1S/C9H7Br2FO2/c1-5(13)14-4-7-8(10)2-6(12)3-9(7)11/h2-3H,4H2,1H3 |
| InChIKey | ACSZRXJPUQDJNW-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.96 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |