C12H12F4O7S — CID 87347581
but-2-yne-1,4-diol;methanesulfonic acid;2,3,5,6-tetrafluorobenzoic acid (PubChem CID 87347581) has the molecular formula C12H12F4O7S and a molecular weight of 376.28 g/mol. Its IUPAC name is but-2-yne-1,4-diol;methanesulfonic acid;2,3,5,6-tetrafluorobenzoic acid.
| Compound Name | but-2-yne-1,4-diol;methanesulfonic acid;2,3,5,6-tetrafluorobenzoic acid |
|---|---|
| PubChem CID | 87347581 |
| Molecular Formula | C12H12F4O7S |
| Molecular Weight | 376.28 g/mol |
| Exact Mass | 376.02 |
| IUPAC Name | but-2-yne-1,4-diol;methanesulfonic acid;2,3,5,6-tetrafluorobenzoic acid |
| SMILES | CS(=O)(=O)O.O=C(O)c1c(F)c(F)cc(F)c1F.OCC#CCO |
| InChI | InChI=1S/C7H2F4O2.C4H6O2.CH4O3S/c8-2-1-3(9)6(11)4(5(2)10)7(12)13;5-3-1-2-4-6;1-5(2,3)4/h1H,(H,12,13);5-6H,3-4H2;1H3,(H,2,3,4) |
| InChIKey | UUVKQRVTUVASRL-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.28 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|