About 2-carboxy-3,4,6-trifluorophenolate
2-carboxy-3,4,6-trifluorophenolate (PubChem CID 164845116) has the molecular formula C7H2F3O3-
and a molecular weight of 191.08 g/mol. Its IUPAC name is 2-carboxy-3,4,6-trifluorophenolate.
Molecular Properties
| Compound Name | 2-carboxy-3,4,6-trifluorophenolate |
| PubChem CID | 164845116 |
| Molecular Formula | C7H2F3O3- |
| Molecular Weight | 191.08 g/mol |
| Exact Mass | 191.00 |
| IUPAC Name | 2-carboxy-3,4,6-trifluorophenolate |
| SMILES | O=C(O)c1c([O-])c(F)cc(F)c1F |
| InChI | InChI=1S/C7H3F3O3/c8-2-1-3(9)6(11)4(5(2)10)7(12)13/h1,11H,(H,12,13)/p-1 |
| InChIKey | JQMMRIICRFAQRQ-UHFFFAOYSA-M |
| XLogP | 0.88 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.08 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 2-carboxy-3,4,6-trifluorophenolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-carboxy-3,4,6-trifluorophenolate?
The IUPAC name of 2-carboxy-3,4,6-trifluorophenolate (CID 164845116) is 2-carboxy-3,4,6-trifluorophenolate.
What is the SMILES notation for 2-carboxy-3,4,6-trifluorophenolate?
The canonical SMILES for 2-carboxy-3,4,6-trifluorophenolate is O=C(O)c1c([O-])c(F)cc(F)c1F.
What is the InChIKey of 2-carboxy-3,4,6-trifluorophenolate?
The InChIKey is JQMMRIICRFAQRQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H3F3O3/c8-2-1-3(9)6(11)4(5(2)10)7(12)13/h1,11H,(H,12,13)/p-1.
What are the key properties of 2-carboxy-3,4,6-trifluorophenolate?
2-carboxy-3,4,6-trifluorophenolate has a molecular weight of 191.08 g/mol, XLogP of 0.88, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-carboxy-3,4,6-trifluorophenolate is sourced from PubChem (CID 164845116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).