C30H6CuF16O4 — CID 139199034
copper bis((Z)-3-oxo-1,3-bis(2,3,5,6-tetrafluorophenyl)prop-1-en-1-olate) (PubChem CID 139199034) has the molecular formula C30H6CuF16O4 and a molecular weight of 797.89 g/mol. Its IUPAC name is copper bis((Z)-3-oxo-1,3-bis(2,3,5,6-tetrafluorophenyl)prop-1-en-1-olate).
| Compound Name | copper bis((Z)-3-oxo-1,3-bis(2,3,5,6-tetrafluorophenyl)prop-1-en-1-olate) |
|---|---|
| PubChem CID | 139199034 |
| Molecular Formula | C30H6CuF16O4 |
| Molecular Weight | 797.89 g/mol |
| Exact Mass | 796.93 |
| IUPAC Name | copper bis((Z)-3-oxo-1,3-bis(2,3,5,6-tetrafluorophenyl)prop-1-en-1-olate) |
| SMILES | O=C(/C=C(\[O-])c1c(F)c(F)cc(F)c1F)c1c(F)c(F)cc(F)c1F.O=C(/C=C(\[O-])c1c(F)c(F)cc(F)c1F)c1c(F)c(F)cc(F)c1F.[Cu+2] |
| InChI | InChI=1S/2C15H4F8O2.Cu/c2*16-4-1-5(17)13(21)10(12(4)20)8(24)3-9(25)11-14(22)6(18)2-7(19)15(11)23;/h2*1-3,24H;/q;;+2/p-2/b2*8-3-; |
| InChIKey | ULVKJYXSRYWKNI-LPOQDMTFSA-L |
| XLogP | 6.76 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 797.89 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|