C9H6BrF3O2 — CID 131380731
2-bromo-1-(2,3,5-trifluoro-6-methoxyphenyl)ethanone (PubChem CID 131380731) has the molecular formula C9H6BrF3O2 and a molecular weight of 283.04 g/mol. Its IUPAC name is 2-bromo-1-(2,3,5-trifluoro-6-methoxyphenyl)ethanone.
| Compound Name | 2-bromo-1-(2,3,5-trifluoro-6-methoxyphenyl)ethanone |
|---|---|
| PubChem CID | 131380731 |
| Molecular Formula | C9H6BrF3O2 |
| Molecular Weight | 283.04 g/mol |
| Exact Mass | 281.95 |
| IUPAC Name | 2-bromo-1-(2,3,5-trifluoro-6-methoxyphenyl)ethanone |
| SMILES | COc1c(F)cc(F)c(F)c1C(=O)CBr |
| InChI | InChI=1S/C9H6BrF3O2/c1-15-9-5(12)2-4(11)8(13)7(9)6(14)3-10/h2H,3H2,1H3 |
| InChIKey | ACZOWBAFDQOVQZ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.04 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|