C8H3F4O3- — CID 7171735
(2R)-2-hydroxy-2-(2,3,5,6-tetrafluorophenyl)acetate (PubChem CID 7171735) has the molecular formula C8H3F4O3- and a molecular weight of 223.10 g/mol. Its IUPAC name is (2R)-2-hydroxy-2-(2,3,5,6-tetrafluorophenyl)acetate.
| Compound Name | (2R)-2-hydroxy-2-(2,3,5,6-tetrafluorophenyl)acetate |
|---|---|
| PubChem CID | 7171735 |
| Molecular Formula | C8H3F4O3- |
| Molecular Weight | 223.10 g/mol |
| Exact Mass | 223.00 |
| IUPAC Name | (2R)-2-hydroxy-2-(2,3,5,6-tetrafluorophenyl)acetate |
| SMILES | O=C([O-])[C@H](O)c1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C8H4F4O3/c9-2-1-3(10)6(12)4(5(2)11)7(13)8(14)15/h1,7,13H,(H,14,15)/p-1/t7-/m1/s1 |
| InChIKey | HKPLPZPFEQLEFM-SSDOTTSWSA-M |
| XLogP | 0.03 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.10 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|