3-amino-3-(2,3,5-trifluoro-6-hydroxyphenyl)propanoic acid

C9H8F3NO3 — CID 117341512

IUPAC3-amino-3-(2,3,5-trifluoro-6-hydroxyphenyl)propanoic acid
SMILESNC(CC(=O)O)c1c(O)c(F)cc(F)c1F
InChIInChI=1S/C9H8F3NO3/c10-3-1-4(11)9(16)7(8(3)12)5(13)2-6(14)15/h1,5,16H,2,13H2,(H,14,15)
InChIKeyPAEZPHKNCFVERP-UHFFFAOYSA-N
MW235.16 g/mol
LogP1.28
Rot. Bonds3

About 3-amino-3-(2,3,5-trifluoro-6-hydroxyphenyl)propanoic acid

3-amino-3-(2,3,5-trifluoro-6-hydroxyphenyl)propanoic acid (PubChem CID 117341512) has the molecular formula C9H8F3NO3 and a molecular weight of 235.16 g/mol. Its IUPAC name is 3-amino-3-(2,3,5-trifluoro-6-hydroxyphenyl)propanoic acid.

Molecular Properties

Compound Name3-amino-3-(2,3,5-trifluoro-6-hydroxyphenyl)propanoic acid
PubChem CID117341512
Molecular FormulaC9H8F3NO3
Molecular Weight235.16 g/mol
Exact Mass235.05
IUPAC Name3-amino-3-(2,3,5-trifluoro-6-hydroxyphenyl)propanoic acid
SMILESNC(CC(=O)O)c1c(O)c(F)cc(F)c1F
InChIInChI=1S/C9H8F3NO3/c10-3-1-4(11)9(16)7(8(3)12)5(13)2-6(14)15/h1,5,16H,2,13H2,(H,14,15)
InChIKeyPAEZPHKNCFVERP-UHFFFAOYSA-N
XLogP1.28
TPSA83.55 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500235.16
LogP ≤ 51.28
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}

Analyze 3-amino-3-(2,3,5-trifluoro-6-hydroxyphenyl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-amino-3-(2,3,5-trifluoro-6-hydroxyphenyl)propanoic acid?
The IUPAC name of 3-amino-3-(2,3,5-trifluoro-6-hydroxyphenyl)propanoic acid (CID 117341512) is 3-amino-3-(2,3,5-trifluoro-6-hydroxyphenyl)propanoic acid.
What is the SMILES notation for 3-amino-3-(2,3,5-trifluoro-6-hydroxyphenyl)propanoic acid?
The canonical SMILES for 3-amino-3-(2,3,5-trifluoro-6-hydroxyphenyl)propanoic acid is NC(CC(=O)O)c1c(O)c(F)cc(F)c1F.
What is the InChIKey of 3-amino-3-(2,3,5-trifluoro-6-hydroxyphenyl)propanoic acid?
The InChIKey is PAEZPHKNCFVERP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8F3NO3/c10-3-1-4(11)9(16)7(8(3)12)5(13)2-6(14)15/h1,5,16H,2,13H2,(H,14,15).
What are the key properties of 3-amino-3-(2,3,5-trifluoro-6-hydroxyphenyl)propanoic acid?
3-amino-3-(2,3,5-trifluoro-6-hydroxyphenyl)propanoic acid has a molecular weight of 235.16 g/mol, XLogP of 1.28, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-3-(2,3,5-trifluoro-6-hydroxyphenyl)propanoic acid is sourced from PubChem (CID 117341512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).