C9H9ClF3NO2 — CID 162344590
(3R)-3-amino-3-(2,3,6-trifluorophenyl)propanoic acid;hydrochloride (PubChem CID 162344590) has the molecular formula C9H9ClF3NO2 and a molecular weight of 255.62 g/mol. Its IUPAC name is (3R)-3-amino-3-(2,3,6-trifluorophenyl)propanoic acid;hydrochloride.
| Compound Name | (3R)-3-amino-3-(2,3,6-trifluorophenyl)propanoic acid;hydrochloride |
|---|---|
| PubChem CID | 162344590 |
| Molecular Formula | C9H9ClF3NO2 |
| Molecular Weight | 255.62 g/mol |
| Exact Mass | 255.03 |
| IUPAC Name | (3R)-3-amino-3-(2,3,6-trifluorophenyl)propanoic acid;hydrochloride |
| SMILES | Cl.N[C@H](CC(=O)O)c1c(F)ccc(F)c1F |
| InChI | InChI=1S/C9H8F3NO2.ClH/c10-4-1-2-5(11)9(12)8(4)6(13)3-7(14)15;/h1-2,6H,3,13H2,(H,14,15);1H/t6-;/m1./s1 |
| InChIKey | FAFOOOBXBBAKIC-FYZOBXCZSA-N |
| XLogP | 2.00 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.62 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|