C9H8BrF2NO2 — CID 117449262
3-amino-3-(3-bromo-2,6-difluorophenyl)propanoic acid (PubChem CID 117449262) has the molecular formula C9H8BrF2NO2 and a molecular weight of 280.07 g/mol. Its IUPAC name is 3-amino-3-(3-bromo-2,6-difluorophenyl)propanoic acid.
| Compound Name | 3-amino-3-(3-bromo-2,6-difluorophenyl)propanoic acid |
|---|---|
| PubChem CID | 117449262 |
| Molecular Formula | C9H8BrF2NO2 |
| Molecular Weight | 280.07 g/mol |
| Exact Mass | 278.97 |
| IUPAC Name | 3-amino-3-(3-bromo-2,6-difluorophenyl)propanoic acid |
| SMILES | NC(CC(=O)O)c1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C9H8BrF2NO2/c10-4-1-2-5(11)8(9(4)12)6(13)3-7(14)15/h1-2,6H,3,13H2,(H,14,15) |
| InChIKey | RMGJSGJNCVPYOJ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.07 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|