C11H8F4O4 — CID 23235309
methyl (E)-3-hydroxy-3-methoxy-2-(2,3,5,6-tetrafluorophenyl)prop-2-enoate (PubChem CID 23235309) has the molecular formula C11H8F4O4 and a molecular weight of 280.17 g/mol. Its IUPAC name is methyl (E)-3-hydroxy-3-methoxy-2-(2,3,5,6-tetrafluorophenyl)prop-2-enoate.
| Compound Name | methyl (E)-3-hydroxy-3-methoxy-2-(2,3,5,6-tetrafluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 23235309 |
| Molecular Formula | C11H8F4O4 |
| Molecular Weight | 280.17 g/mol |
| Exact Mass | 280.04 |
| IUPAC Name | methyl (E)-3-hydroxy-3-methoxy-2-(2,3,5,6-tetrafluorophenyl)prop-2-enoate |
| SMILES | COC(=O)/C(=C(\O)OC)c1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C11H8F4O4/c1-18-10(16)7(11(17)19-2)6-8(14)4(12)3-5(13)9(6)15/h3,16H,1-2H3/b10-7+ |
| InChIKey | IMYSZRWOCYJJHV-JXMROGBWSA-N |
| XLogP | 2.29 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.17 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|