C10H9F4NO3 — CID 107645191
3-methoxy-2-(2,3,5,6-tetrafluoroanilino)propanoic acid (PubChem CID 107645191) has the molecular formula C10H9F4NO3 and a molecular weight of 267.18 g/mol. Its IUPAC name is 3-methoxy-2-(2,3,5,6-tetrafluoroanilino)propanoic acid.
| Compound Name | 3-methoxy-2-(2,3,5,6-tetrafluoroanilino)propanoic acid |
|---|---|
| PubChem CID | 107645191 |
| Molecular Formula | C10H9F4NO3 |
| Molecular Weight | 267.18 g/mol |
| Exact Mass | 267.05 |
| IUPAC Name | 3-methoxy-2-(2,3,5,6-tetrafluoroanilino)propanoic acid |
| SMILES | COCC(Nc1c(F)c(F)cc(F)c1F)C(=O)O |
| InChI | InChI=1S/C10H9F4NO3/c1-18-3-6(10(16)17)15-9-7(13)4(11)2-5(12)8(9)14/h2,6,15H,3H2,1H3,(H,16,17) |
| InChIKey | KACAPEOSTUZSDQ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.18 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|