C11H13FN2O6 — CID 81078496
2-(4-fluoro-5-methoxy-2-nitroanilino)-3-methoxypropanoic acid (PubChem CID 81078496) has the molecular formula C11H13FN2O6 and a molecular weight of 288.23 g/mol. Its IUPAC name is 2-(4-fluoro-5-methoxy-2-nitroanilino)-3-methoxypropanoic acid.
| Compound Name | 2-(4-fluoro-5-methoxy-2-nitroanilino)-3-methoxypropanoic acid |
|---|---|
| PubChem CID | 81078496 |
| Molecular Formula | C11H13FN2O6 |
| Molecular Weight | 288.23 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | 2-(4-fluoro-5-methoxy-2-nitroanilino)-3-methoxypropanoic acid |
| SMILES | COCC(Nc1cc(OC)c(F)cc1[N+](=O)[O-])C(=O)O |
| InChI | InChI=1S/C11H13FN2O6/c1-19-5-8(11(15)16)13-7-4-10(20-2)6(12)3-9(7)14(17)18/h3-4,8,13H,5H2,1-2H3,(H,15,16) |
| InChIKey | ANEVNUYHFCAFOL-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 110.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.23 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|