C10H10Cl2N2O5 — CID 81078952
2-(4,5-dichloro-2-nitroanilino)-3-methoxypropanoic acid (PubChem CID 81078952) has the molecular formula C10H10Cl2N2O5 and a molecular weight of 309.11 g/mol. Its IUPAC name is 2-(4,5-dichloro-2-nitroanilino)-3-methoxypropanoic acid.
| Compound Name | 2-(4,5-dichloro-2-nitroanilino)-3-methoxypropanoic acid |
|---|---|
| PubChem CID | 81078952 |
| Molecular Formula | C10H10Cl2N2O5 |
| Molecular Weight | 309.11 g/mol |
| Exact Mass | 308.00 |
| IUPAC Name | 2-(4,5-dichloro-2-nitroanilino)-3-methoxypropanoic acid |
| SMILES | COCC(Nc1cc(Cl)c(Cl)cc1[N+](=O)[O-])C(=O)O |
| InChI | InChI=1S/C10H10Cl2N2O5/c1-19-4-8(10(15)16)13-7-2-5(11)6(12)3-9(7)14(17)18/h2-3,8,13H,4H2,1H3,(H,15,16) |
| InChIKey | GVIKXUMPPKQVHN-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.11 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|