C20H24F5IO3S — CID 87772789
ditert-butyl(phenyl)-λ3-iodane;2,3,4,5,6-pentafluorobenzenesulfonic acid (PubChem CID 87772789) has the molecular formula C20H24F5IO3S and a molecular weight of 566.37 g/mol. Its IUPAC name is ditert-butyl(phenyl)-λ3-iodane;2,3,4,5,6-pentafluorobenzenesulfonic acid.
| Compound Name | ditert-butyl(phenyl)-λ3-iodane;2,3,4,5,6-pentafluorobenzenesulfonic acid |
|---|---|
| PubChem CID | 87772789 |
| Molecular Formula | C20H24F5IO3S |
| Molecular Weight | 566.37 g/mol |
| Exact Mass | 566.04 |
| IUPAC Name | ditert-butyl(phenyl)-λ3-iodane;2,3,4,5,6-pentafluorobenzenesulfonic acid |
| SMILES | CC(C)(C)I(c1ccccc1)C(C)(C)C.O=S(=O)(O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C14H23I.C6HF5O3S/c1-13(2,3)15(14(4,5)6)12-10-8-7-9-11-12;7-1-2(8)4(10)6(15(12,13)14)5(11)3(1)9/h7-11H,1-6H3;(H,12,13,14) |
| InChIKey | KODZLDGOQUBHQS-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.37 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|