C10H11F3O4S — CID 170366954
2,3,5-trifluoro-6-methyl-4-propan-2-yloxybenzenesulfonic acid (PubChem CID 170366954) has the molecular formula C10H11F3O4S and a molecular weight of 284.25 g/mol. Its IUPAC name is 2,3,5-trifluoro-6-methyl-4-propan-2-yloxybenzenesulfonic acid.
| Compound Name | 2,3,5-trifluoro-6-methyl-4-propan-2-yloxybenzenesulfonic acid |
|---|---|
| PubChem CID | 170366954 |
| Molecular Formula | C10H11F3O4S |
| Molecular Weight | 284.25 g/mol |
| Exact Mass | 284.03 |
| IUPAC Name | 2,3,5-trifluoro-6-methyl-4-propan-2-yloxybenzenesulfonic acid |
| SMILES | Cc1c(F)c(OC(C)C)c(F)c(F)c1S(=O)(=O)O |
| InChI | InChI=1S/C10H11F3O4S/c1-4(2)17-9-6(11)5(3)10(18(14,15)16)8(13)7(9)12/h4H,1-3H3,(H,14,15,16) |
| InChIKey | NNSQIIGDHWHNGW-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.25 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|