C11H14F2O — CID 143612370
2,3-difluoro-1,5-dimethyl-4-propan-2-yloxybenzene (PubChem CID 143612370) has the molecular formula C11H14F2O and a molecular weight of 200.23 g/mol. Its IUPAC name is 2,3-difluoro-1,5-dimethyl-4-propan-2-yloxybenzene.
| Compound Name | 2,3-difluoro-1,5-dimethyl-4-propan-2-yloxybenzene |
|---|---|
| PubChem CID | 143612370 |
| Molecular Formula | C11H14F2O |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | 2,3-difluoro-1,5-dimethyl-4-propan-2-yloxybenzene |
| SMILES | Cc1cc(C)c(OC(C)C)c(F)c1F |
| InChI | InChI=1S/C11H14F2O/c1-6(2)14-11-8(4)5-7(3)9(12)10(11)13/h5-6H,1-4H3 |
| InChIKey | NTLVZNFLLQABEK-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |