C11H16ClNO — CID 82266805
3-chloro-2,5-dimethyl-6-propan-2-yloxyaniline (PubChem CID 82266805) has the molecular formula C11H16ClNO and a molecular weight of 213.71 g/mol. Its IUPAC name is 3-chloro-2,5-dimethyl-6-propan-2-yloxyaniline.
| Compound Name | 3-chloro-2,5-dimethyl-6-propan-2-yloxyaniline |
|---|---|
| PubChem CID | 82266805 |
| Molecular Formula | C11H16ClNO |
| Molecular Weight | 213.71 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | 3-chloro-2,5-dimethyl-6-propan-2-yloxyaniline |
| SMILES | Cc1cc(Cl)c(C)c(N)c1OC(C)C |
| InChI | InChI=1S/C11H16ClNO/c1-6(2)14-11-7(3)5-9(12)8(4)10(11)13/h5-6H,13H2,1-4H3 |
| InChIKey | FGKFLUSAPUORPK-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.71 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|