C17H11F4I3O6S — CID 153471623
2,3,5,6-tetrafluoro-4-[2-[(3-hydroxy-2,4,6-triiodophenyl)methyl]butanoyloxy]benzenesulfonic acid (PubChem CID 153471623) has the molecular formula C17H11F4I3O6S and a molecular weight of 800.04 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-[2-[(3-hydroxy-2,4,6-triiodophenyl)methyl]butanoyloxy]benzenesulfonic acid.
| Compound Name | 2,3,5,6-tetrafluoro-4-[2-[(3-hydroxy-2,4,6-triiodophenyl)methyl]butanoyloxy]benzenesulfonic acid |
|---|---|
| PubChem CID | 153471623 |
| Molecular Formula | C17H11F4I3O6S |
| Molecular Weight | 800.04 g/mol |
| Exact Mass | 799.73 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-[2-[(3-hydroxy-2,4,6-triiodophenyl)methyl]butanoyloxy]benzenesulfonic acid |
| SMILES | CCC(Cc1c(I)cc(I)c(O)c1I)C(=O)Oc1c(F)c(F)c(S(=O)(=O)O)c(F)c1F |
| InChI | InChI=1S/C17H11F4I3O6S/c1-2-5(3-6-7(22)4-8(23)14(25)13(6)24)17(26)30-15-9(18)11(20)16(31(27,28)29)12(21)10(15)19/h4-5,25H,2-3H2,1H3,(H,27,28,29) |
| InChIKey | XMYCGNYKVZGLKL-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 800.04 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|