C23H34F4O14S — CID 170089143
2,3,5,6-tetrafluoro-4-[3-hydroxy-2-[2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoyl]oxybenzenesulfonic acid (PubChem CID 170089143) has the molecular formula C23H34F4O14S and a molecular weight of 642.57 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-[3-hydroxy-2-[2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoyl]oxybenzenesulfonic acid.
| Compound Name | 2,3,5,6-tetrafluoro-4-[3-hydroxy-2-[2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoyl]oxybenzenesulfonic acid |
|---|---|
| PubChem CID | 170089143 |
| Molecular Formula | C23H34F4O14S |
| Molecular Weight | 642.57 g/mol |
| Exact Mass | 642.16 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-[3-hydroxy-2-[2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoyl]oxybenzenesulfonic acid |
| SMILES | O=C(Oc1c(F)c(F)c(S(=O)(=O)O)c(F)c1F)C(CO)OCCOCCOCCOCCOCCOCCOCCO |
| InChI | InChI=1S/C23H34F4O14S/c24-17-19(26)22(42(31,32)33)20(27)18(25)21(17)41-23(30)16(15-29)40-14-13-39-12-11-38-10-9-37-8-7-36-6-5-35-4-3-34-2-1-28/h16,28-29H,1-15H2,(H,31,32,33) |
| InChIKey | IVGMPHSORKIAFG-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 185.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.57 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|