C29H22FI3O3S — CID 167570560
5-(4-fluorophenyl)dibenzothiophen-5-ium;2-[(3-hydroxy-2,4,6-triiodophenyl)methyl]butanoate (PubChem CID 167570560) has the molecular formula C29H22FI3O3S and a molecular weight of 850.27 g/mol. Its IUPAC name is 5-(4-fluorophenyl)dibenzothiophen-5-ium;2-[(3-hydroxy-2,4,6-triiodophenyl)methyl]butanoate.
| Compound Name | 5-(4-fluorophenyl)dibenzothiophen-5-ium;2-[(3-hydroxy-2,4,6-triiodophenyl)methyl]butanoate |
|---|---|
| PubChem CID | 167570560 |
| Molecular Formula | C29H22FI3O3S |
| Molecular Weight | 850.27 g/mol |
| Exact Mass | 849.84 |
| IUPAC Name | 5-(4-fluorophenyl)dibenzothiophen-5-ium;2-[(3-hydroxy-2,4,6-triiodophenyl)methyl]butanoate |
| SMILES | CCC(Cc1c(I)cc(I)c(O)c1I)C(=O)[O-].Fc1ccc(-[s+]2c3ccccc3c3ccccc32)cc1 |
| InChI | InChI=1S/C18H12FS.C11H11I3O3/c19-13-9-11-14(12-10-13)20-17-7-3-1-5-15(17)16-6-2-4-8-18(16)20;1-2-5(11(16)17)3-6-7(12)4-8(13)10(15)9(6)14/h1-12H;4-5,15H,2-3H2,1H3,(H,16,17)/q+1;/p-1 |
| InChIKey | FVUGMXZRSDMUQK-UHFFFAOYSA-M |
| XLogP | 8.40 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 850.27 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|