C24H22BrO3S+ — CID 156683971
1-(4-dibenzothiophen-5-ium-5-ylphenoxy)propyl 2-bromopropanoate (PubChem CID 156683971) has the molecular formula C24H22BrO3S+ and a molecular weight of 470.41 g/mol. Its IUPAC name is 1-(4-dibenzothiophen-5-ium-5-ylphenoxy)propyl 2-bromopropanoate.
| Compound Name | 1-(4-dibenzothiophen-5-ium-5-ylphenoxy)propyl 2-bromopropanoate |
|---|---|
| PubChem CID | 156683971 |
| Molecular Formula | C24H22BrO3S+ |
| Molecular Weight | 470.41 g/mol |
| Exact Mass | 469.05 |
| IUPAC Name | 1-(4-dibenzothiophen-5-ium-5-ylphenoxy)propyl 2-bromopropanoate |
| SMILES | CCC(OC(=O)C(C)Br)Oc1ccc(-[s+]2c3ccccc3c3ccccc32)cc1 |
| InChI | InChI=1S/C24H22BrO3S/c1-3-23(28-24(26)16(2)25)27-17-12-14-18(15-13-17)29-21-10-6-4-8-19(21)20-9-5-7-11-22(20)29/h4-16,23H,3H2,1-2H3/q+1 |
| InChIKey | XGVRDEQJYNBSJE-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.41 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|