C29H36O8 — CID 141012098
1-[4-[2-[4-[1-[(Z)-2-hydroxybut-2-enoyl]oxypropoxy]phenyl]propan-2-yl]phenoxy]propyl (Z)-2-hydroxybut-2-enoate (PubChem CID 141012098) has the molecular formula C29H36O8 and a molecular weight of 512.60 g/mol. Its IUPAC name is 1-[4-[2-[4-[1-[(Z)-2-hydroxybut-2-enoyl]oxypropoxy]phenyl]propan-2-yl]phenoxy]propyl (Z)-2-hydroxybut-2-enoate.
| Compound Name | 1-[4-[2-[4-[1-[(Z)-2-hydroxybut-2-enoyl]oxypropoxy]phenyl]propan-2-yl]phenoxy]propyl (Z)-2-hydroxybut-2-enoate |
|---|---|
| PubChem CID | 141012098 |
| Molecular Formula | C29H36O8 |
| Molecular Weight | 512.60 g/mol |
| Exact Mass | 512.24 |
| IUPAC Name | 1-[4-[2-[4-[1-[(Z)-2-hydroxybut-2-enoyl]oxypropoxy]phenyl]propan-2-yl]phenoxy]propyl (Z)-2-hydroxybut-2-enoate |
| SMILES | C/C=C(\O)C(=O)OC(CC)Oc1ccc(C(C)(C)c2ccc(OC(CC)OC(=O)/C(O)=C/C)cc2)cc1 |
| InChI | InChI=1S/C29H36O8/c1-7-23(30)27(32)36-25(9-3)34-21-15-11-19(12-16-21)29(5,6)20-13-17-22(18-14-20)35-26(10-4)37-28(33)24(31)8-2/h7-8,11-18,25-26,30-31H,9-10H2,1-6H3/b23-7-,24-8- |
| InChIKey | JMPDBXAHWVYRGL-YLSUZJBISA-N |
| XLogP | 6.25 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.60 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|